C27H30F2N6O — CID 56941340
N-[8-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 56941340) has the molecular formula C27H30F2N6O and a molecular weight of 492.57 g/mol. Its IUPAC name is N-[8-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-[8-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 56941340 |
| Molecular Formula | C27H30F2N6O |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-[8-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | Cc1cc(-c2n[nH]c3c2CN(C(=O)NC2CC4CCC(C2)N4Cc2c(F)cccc2F)CC3)ccn1 |
| InChI | InChI=1S/C27H30F2N6O/c1-16-11-17(7-9-30-16)26-22-14-34(10-8-25(22)32-33-26)27(36)31-18-12-19-5-6-20(13-18)35(19)15-21-23(28)3-2-4-24(21)29/h2-4,7,9,11,18-20H,5-6,8,10,12-15H2,1H3,(H,31,36)(H,32,33) |
| InChIKey | DEAWDDZNPICHJG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |