C25H31N7O2S — CID 56941864
1-[(3S)-3-[[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 56941864) has the molecular formula C25H31N7O2S and a molecular weight of 493.64 g/mol. Its IUPAC name is 1-[(3S)-3-[[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56941864 |
| Molecular Formula | C25H31N7O2S |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 1-[(3S)-3-[[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H](Nc2cc(CN3C[C@@H](C)O[C@@H](C)C3)cc(Nc3nc4cccnc4s3)n2)C1 |
| InChI | InChI=1S/C25H31N7O2S/c1-4-23(33)32-9-7-19(15-32)27-21-10-18(14-31-12-16(2)34-17(3)13-31)11-22(29-21)30-25-28-20-6-5-8-26-24(20)35-25/h4-6,8,10-11,16-17,19H,1,7,9,12-15H2,2-3H3,(H2,27,28,29,30)/t16-,17+,19-/m0/s1 |
| InChIKey | QUZOSUHDRJIKQK-SCTDSRPQSA-N |
| XLogP | 3.64 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|