C26H22N2O3 — CID 56942104
(E)-3-[4-[(E)-4-hydroxy-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 56942104) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is (E)-3-[4-[(E)-4-hydroxy-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-4-hydroxy-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 56942104 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (E)-3-[4-[(E)-4-hydroxy-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C(=C(/CCO)c2ccccc2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C26H22N2O3/c29-15-14-23(19-4-2-1-3-5-19)26(21-11-12-24-22(16-21)17-27-28-24)20-9-6-18(7-10-20)8-13-25(30)31/h1-13,16-17,29H,14-15H2,(H,27,28)(H,30,31)/b13-8+,26-23+ |
| InChIKey | RQMGXFBLPIATQC-LDPXRHKHSA-N |
| XLogP | 5.00 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|