C20H14F2N4OSe — CID 56942234
2-fluoro-N-[5-[3-(2-fluorophenyl)-1-methylpyrazol-5-yl]-1,3-selenazol-2-yl]benzamide (PubChem CID 56942234) has the molecular formula C20H14F2N4OSe and a molecular weight of 443.32 g/mol. Its IUPAC name is 2-fluoro-N-[5-[3-(2-fluorophenyl)-1-methylpyrazol-5-yl]-1,3-selenazol-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[5-[3-(2-fluorophenyl)-1-methylpyrazol-5-yl]-1,3-selenazol-2-yl]benzamide |
|---|---|
| PubChem CID | 56942234 |
| Molecular Formula | C20H14F2N4OSe |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-fluoro-N-[5-[3-(2-fluorophenyl)-1-methylpyrazol-5-yl]-1,3-selenazol-2-yl]benzamide |
| SMILES | Cn1nc(-c2ccccc2F)cc1-c1cnc(NC(=O)c2ccccc2F)[se]1 |
| InChI | InChI=1S/C20H14F2N4OSe/c1-26-17(10-16(25-26)12-6-2-4-8-14(12)21)18-11-23-20(28-18)24-19(27)13-7-3-5-9-15(13)22/h2-11H,1H3,(H,23,24,27) |
| InChIKey | ABSMVSLPEWAQFP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|