C34H25F6NO3SSe — CID 56942254
2-[2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]selanylphenoxy]acetic acid (PubChem CID 56942254) has the molecular formula C34H25F6NO3SSe and a molecular weight of 720.59 g/mol. Its IUPAC name is 2-[2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]selanylphenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]selanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 56942254 |
| Molecular Formula | C34H25F6NO3SSe |
| Molecular Weight | 720.59 g/mol |
| Exact Mass | 721.06 |
| IUPAC Name | 2-[2-methyl-4-[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]selanylphenoxy]acetic acid |
| SMILES | Cc1cc([Se]C(Cc2ccc(-c3cc(F)c(F)c(F)c3)cc2)c2sc(-c3ccc(C(F)(F)F)cc3)nc2C)ccc1OCC(=O)O |
| InChI | InChI=1S/C34H25F6NO3SSe/c1-18-13-25(11-12-28(18)44-17-30(42)43)46-29(14-20-3-5-21(6-4-20)23-15-26(35)31(37)27(36)16-23)32-19(2)41-33(45-32)22-7-9-24(10-8-22)34(38,39)40/h3-13,15-16,29H,14,17H2,1-2H3,(H,42,43) |
| InChIKey | ZVCOTZAVLJRTIJ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.59 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|