About (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene
(1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene (PubChem CID 56942263) has the molecular formula C10H18O2S
and a molecular weight of 202.32 g/mol. Its IUPAC name is (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene.
Molecular Properties
| Compound Name | (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene |
| PubChem CID | 56942263 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene |
| SMILES | CC(C)=CCC/C(C)=C/S(C)(=O)=O |
| InChI | InChI=1S/C10H18O2S/c1-9(2)6-5-7-10(3)8-13(4,11)12/h6,8H,5,7H2,1-4H3/b10-8+ |
| InChIKey | XYMVSHOREWBSIN-CSKARUKUSA-N |
| XLogP | 2.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene?
The IUPAC name of (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene (CID 56942263) is (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene.
What is the SMILES notation for (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene?
The canonical SMILES for (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene is CC(C)=CCC/C(C)=C/S(C)(=O)=O.
What is the InChIKey of (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene?
The InChIKey is XYMVSHOREWBSIN-CSKARUKUSA-N. The full InChI is InChI=1S/C10H18O2S/c1-9(2)6-5-7-10(3)8-13(4,11)12/h6,8H,5,7H2,1-4H3/b10-8+.
What are the key properties of (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene?
(1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene has a molecular weight of 202.32 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2,6-dimethyl-1-methylsulfonylhepta-1,5-diene is sourced from PubChem (CID 56942263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).