C18H23F2NO3 — CID 56942331
tert-butyl 3-benzyl-3-(difluoromethyl)-2-oxopiperidine-1-carboxylate (PubChem CID 56942331) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is tert-butyl 3-benzyl-3-(difluoromethyl)-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-benzyl-3-(difluoromethyl)-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 56942331 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl 3-benzyl-3-(difluoromethyl)-2-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Cc2ccccc2)(C(F)F)C1=O |
| InChI | InChI=1S/C18H23F2NO3/c1-17(2,3)24-16(23)21-11-7-10-18(14(19)20,15(21)22)12-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3 |
| InChIKey | TWGYGLHJZQUXAD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |