C30H29Cl2FN4O5 — CID 56942376
4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-pyrrolo[3,2-b]pyridine-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid (PubChem CID 56942376) has the molecular formula C30H29Cl2FN4O5 and a molecular weight of 615.49 g/mol. Its IUPAC name is 4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-pyrrolo[3,2-b]pyridine-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-pyrrolo[3,2-b]pyridine-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 56942376 |
| Molecular Formula | C30H29Cl2FN4O5 |
| Molecular Weight | 615.49 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-pyrrolo[3,2-b]pyridine-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@@]2(C(=O)Nc3ccc(Cl)nc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C30H29Cl2FN4O5/c1-29(2,3)13-20-30(25-18(35-28(30)41)10-11-21(32)37-25)22(15-6-5-7-16(31)23(15)33)24(36-20)26(38)34-17-9-8-14(27(39)40)12-19(17)42-4/h5-12,20,22,24,36H,13H2,1-4H3,(H,34,38)(H,35,41)(H,39,40)/t20-,22-,24+,30+/m0/s1 |
| InChIKey | UUPRVEMOCXXAIB-MKNBMTNBSA-N |
| XLogP | 5.62 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|