C10H19NO2S — CID 56942411
(1Z)-N,2,6-trimethylhepta-1,5-diene-1-sulfonamide (PubChem CID 56942411) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is (1Z)-N,2,6-trimethylhepta-1,5-diene-1-sulfonamide.
| Compound Name | (1Z)-N,2,6-trimethylhepta-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 56942411 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1Z)-N,2,6-trimethylhepta-1,5-diene-1-sulfonamide |
| SMILES | CNS(=O)(=O)/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C10H19NO2S/c1-9(2)6-5-7-10(3)8-14(12,13)11-4/h6,8,11H,5,7H2,1-4H3/b10-8- |
| InChIKey | LSSRHEDYTNQXIZ-NTMALXAHSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|