About (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide
(1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide (PubChem CID 56942413) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide |
| PubChem CID | 56942413 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/S(N)(=O)=O |
| InChI | InChI=1S/C9H17NO2S/c1-8(2)5-4-6-9(3)7-13(10,11)12/h5,7H,4,6H2,1-3H3,(H2,10,11,12)/b9-7+ |
| InChIKey | IMAPKCUDRYUNRE-VQHVLOKHSA-N |
| XLogP | 1.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
The IUPAC name of (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide (CID 56942413) is (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide.
What is the SMILES notation for (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
The canonical SMILES for (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide is CC(C)=CCC/C(C)=C/S(N)(=O)=O.
What is the InChIKey of (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
The InChIKey is IMAPKCUDRYUNRE-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-8(2)5-4-6-9(3)7-13(10,11)12/h5,7H,4,6H2,1-3H3,(H2,10,11,12)/b9-7+.
What are the key properties of (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
(1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide has a molecular weight of 203.31 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2,6-dimethylhepta-1,5-diene-1-sulfonamide is sourced from PubChem (CID 56942413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).