C11H18F3NO2S — CID 56942559
(1Z)-2,6-dimethyl-N-(2,2,2-trifluoroethyl)hepta-1,5-diene-1-sulfonamide (PubChem CID 56942559) has the molecular formula C11H18F3NO2S and a molecular weight of 285.33 g/mol. Its IUPAC name is (1Z)-2,6-dimethyl-N-(2,2,2-trifluoroethyl)hepta-1,5-diene-1-sulfonamide.
| Compound Name | (1Z)-2,6-dimethyl-N-(2,2,2-trifluoroethyl)hepta-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 56942559 |
| Molecular Formula | C11H18F3NO2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (1Z)-2,6-dimethyl-N-(2,2,2-trifluoroethyl)hepta-1,5-diene-1-sulfonamide |
| SMILES | CC(C)=CCC/C(C)=C\S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO2S/c1-9(2)5-4-6-10(3)7-18(16,17)15-8-11(12,13)14/h5,7,15H,4,6,8H2,1-3H3/b10-7- |
| InChIKey | BKWXNOAGSMUQCE-YFHOEESVSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|