C26H33N7O2S — CID 56942596
(E)-1-[(3S)-3-[[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 56942596) has the molecular formula C26H33N7O2S and a molecular weight of 507.66 g/mol. Its IUPAC name is (E)-1-[(3S)-3-[[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(3S)-3-[[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 56942596 |
| Molecular Formula | C26H33N7O2S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | (E)-1-[(3S)-3-[[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)-2-pyridinyl]amino]pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CC[C@H](Nc2cc(CN3C[C@@H](C)O[C@@H](C)C3)cc(Nc3nc4cccnc4s3)n2)C1 |
| InChI | InChI=1S/C26H33N7O2S/c1-4-6-24(34)33-10-8-20(16-33)28-22-11-19(15-32-13-17(2)35-18(3)14-32)12-23(30-22)31-26-29-21-7-5-9-27-25(21)36-26/h4-7,9,11-12,17-18,20H,8,10,13-16H2,1-3H3,(H2,28,29,30,31)/b6-4+/t17-,18+,20-/m0/s1 |
| InChIKey | JYWRGJBVHXCABZ-RKMFKKCNSA-N |
| XLogP | 4.03 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|