C28H32N6OS — CID 56942655
N-[1-(1-benzothiophen-3-ylmethyl)-3-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 56942655) has the molecular formula C28H32N6OS and a molecular weight of 500.67 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-3-ylmethyl)-3-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-[1-(1-benzothiophen-3-ylmethyl)-3-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 56942655 |
| Molecular Formula | C28H32N6OS |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-[1-(1-benzothiophen-3-ylmethyl)-3-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | Cc1cc(-c2n[nH]c3c2CN(C(=O)NC2(C)CCCN(Cc4csc5ccccc45)C2)CC3)ccn1 |
| InChI | InChI=1S/C28H32N6OS/c1-19-14-20(8-11-29-19)26-23-16-34(13-9-24(23)31-32-26)27(35)30-28(2)10-5-12-33(18-28)15-21-17-36-25-7-4-3-6-22(21)25/h3-4,6-8,11,14,17H,5,9-10,12-13,15-16,18H2,1-2H3,(H,30,35)(H,31,32) |
| InChIKey | PSWFXVCEFQHNHQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |