C26H23FN6O2 — CID 56943117
6-[4-(4-fluorophenoxy)phenyl]-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 56943117) has the molecular formula C26H23FN6O2 and a molecular weight of 470.51 g/mol. Its IUPAC name is 6-[4-(4-fluorophenoxy)phenyl]-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | 6-[4-(4-fluorophenoxy)phenyl]-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56943117 |
| Molecular Formula | C26H23FN6O2 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 6-[4-(4-fluorophenoxy)phenyl]-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(N2CCN(c3ncccn3)CC2)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C26H23FN6O2/c27-19-4-8-22(9-5-19)35-21-6-2-18(3-7-21)23-16-20(17-24(31-23)25(28)34)32-12-14-33(15-13-32)26-29-10-1-11-30-26/h1-11,16-17H,12-15H2,(H2,28,34) |
| InChIKey | KGYFJEIXFAXWHJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |