C18H14F3NO4 — CID 56943132
5-(2,4,5-trifluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole (PubChem CID 56943132) has the molecular formula C18H14F3NO4 and a molecular weight of 365.31 g/mol. Its IUPAC name is 5-(2,4,5-trifluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole.
| Compound Name | 5-(2,4,5-trifluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 56943132 |
| Molecular Formula | C18H14F3NO4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-(2,4,5-trifluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole |
| SMILES | COc1cc(-c2ncoc2-c2cc(F)c(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H14F3NO4/c1-23-14-4-9(5-15(24-2)18(14)25-3)16-17(26-8-22-16)10-6-12(20)13(21)7-11(10)19/h4-8H,1-3H3 |
| InChIKey | MCPKPMMBWGHYGW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|