C27H24F5N5O2S2 — CID 56943175
N-[4-[4-(1,1,2,2,2-pentafluoroethyl)-5-(2-piperidin-1-ylethylcarbamoyl)-1,3-thiazol-2-yl]phenyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 56943175) has the molecular formula C27H24F5N5O2S2 and a molecular weight of 609.65 g/mol. Its IUPAC name is N-[4-[4-(1,1,2,2,2-pentafluoroethyl)-5-(2-piperidin-1-ylethylcarbamoyl)-1,3-thiazol-2-yl]phenyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(1,1,2,2,2-pentafluoroethyl)-5-(2-piperidin-1-ylethylcarbamoyl)-1,3-thiazol-2-yl]phenyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56943175 |
| Molecular Formula | C27H24F5N5O2S2 |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | N-[4-[4-(1,1,2,2,2-pentafluoroethyl)-5-(2-piperidin-1-ylethylcarbamoyl)-1,3-thiazol-2-yl]phenyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc(C(F)(F)C(F)(F)F)c(C(=O)NCCN3CCCCC3)s2)cc1)c1cc2cccnc2s1 |
| InChI | InChI=1S/C27H24F5N5O2S2/c28-26(29,27(30,31)32)21-20(23(39)33-11-14-37-12-2-1-3-13-37)41-25(36-21)16-6-8-18(9-7-16)35-22(38)19-15-17-5-4-10-34-24(17)40-19/h4-10,15H,1-3,11-14H2,(H,33,39)(H,35,38) |
| InChIKey | QMGUKHHYCDHRNS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|