About 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide
6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide (PubChem CID 56943194) has the molecular formula C20H17FN2O4
and a molecular weight of 368.36 g/mol. Its IUPAC name is 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide |
| PubChem CID | 56943194 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(Oc3ccc(F)cc3)cc2)cc([C@@H](O)CO)n1 |
| InChI | InChI=1S/C20H17FN2O4/c21-14-3-7-16(8-4-14)27-15-5-1-12(2-6-15)13-9-17(19(25)11-24)23-18(10-13)20(22)26/h1-10,19,24-25H,11H2,(H2,22,26)/t19-/m0/s1 |
| InChIKey | XPEOHPFVNQOFMU-IBGZPJMESA-N |
| XLogP | 2.80 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide?
The IUPAC name of 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide (CID 56943194) is 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide.
What is the SMILES notation for 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide?
The canonical SMILES for 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide is NC(=O)c1cc(-c2ccc(Oc3ccc(F)cc3)cc2)cc([C@@H](O)CO)n1.
What is the InChIKey of 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide?
The InChIKey is XPEOHPFVNQOFMU-IBGZPJMESA-N. The full InChI is InChI=1S/C20H17FN2O4/c21-14-3-7-16(8-4-14)27-15-5-1-12(2-6-15)13-9-17(19(25)11-24)23-18(10-13)20(22)26/h1-10,19,24-25H,11H2,(H2,22,26)/t19-/m0/s1.
What are the key properties of 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide?
6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide has a molecular weight of 368.36 g/mol, XLogP of 2.80, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1R)-1,2-dihydroxyethyl]-4-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxamide is sourced from PubChem (CID 56943194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).