About [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone
[2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone (PubChem CID 569433) has the molecular formula C14H7Cl2F3O
and a molecular weight of 319.11 g/mol. Its IUPAC name is [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone |
| PubChem CID | 569433 |
| Molecular Formula | C14H7Cl2F3O |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H7Cl2F3O/c15-10-6-9(14(17,18)19)7-11(16)12(10)13(20)8-4-2-1-3-5-8/h1-7H |
| InChIKey | JDQQCAQGKKODAJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone?
The IUPAC name of [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone (CID 569433) is [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone.
What is the SMILES notation for [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone?
The canonical SMILES for [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone is O=C(c1ccccc1)c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone?
The InChIKey is JDQQCAQGKKODAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Cl2F3O/c15-10-6-9(14(17,18)19)7-11(16)12(10)13(20)8-4-2-1-3-5-8/h1-7H.
What are the key properties of [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone?
[2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone has a molecular weight of 319.11 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dichloro-4-(trifluoromethyl)phenyl]-phenylmethanone is sourced from PubChem (CID 569433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).