C26H22F2N4O3 — CID 56943681
[2-amino-6-[4,5-difluoro-2-(2-hydroxyethoxymethyl)phenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 56943681) has the molecular formula C26H22F2N4O3 and a molecular weight of 476.48 g/mol. Its IUPAC name is [2-amino-6-[4,5-difluoro-2-(2-hydroxyethoxymethyl)phenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [2-amino-6-[4,5-difluoro-2-(2-hydroxyethoxymethyl)phenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 56943681 |
| Molecular Formula | C26H22F2N4O3 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [2-amino-6-[4,5-difluoro-2-(2-hydroxyethoxymethyl)phenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | Nc1nc(C(=O)N2Cc3ccccc3C2)c2cc(-c3cc(F)c(F)cc3COCCO)ccc2n1 |
| InChI | InChI=1S/C26H22F2N4O3/c27-21-10-18(14-35-8-7-33)19(11-22(21)28)15-5-6-23-20(9-15)24(31-26(29)30-23)25(34)32-12-16-3-1-2-4-17(16)13-32/h1-6,9-11,33H,7-8,12-14H2,(H2,29,30,31) |
| InChIKey | DZGSNUXSXNFGOG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|