C24H19F2N5O2 — CID 56943776
[2-amino-6-[2-(aminooxymethyl)-4,5-difluorophenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 56943776) has the molecular formula C24H19F2N5O2 and a molecular weight of 447.45 g/mol. Its IUPAC name is [2-amino-6-[2-(aminooxymethyl)-4,5-difluorophenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [2-amino-6-[2-(aminooxymethyl)-4,5-difluorophenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 56943776 |
| Molecular Formula | C24H19F2N5O2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-amino-6-[2-(aminooxymethyl)-4,5-difluorophenyl]quinazolin-4-yl]-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | NOCc1cc(F)c(F)cc1-c1ccc2nc(N)nc(C(=O)N3Cc4ccccc4C3)c2c1 |
| InChI | InChI=1S/C24H19F2N5O2/c25-19-8-16(12-33-28)17(9-20(19)26)13-5-6-21-18(7-13)22(30-24(27)29-21)23(32)31-10-14-3-1-2-4-15(14)11-31/h1-9H,10-12,28H2,(H2,27,29,30) |
| InChIKey | VINCHMBSAJGOCA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|