C40H46F2N6O7 — CID 56943877
[2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 56943877) has the molecular formula C40H46F2N6O7 and a molecular weight of 760.84 g/mol. Its IUPAC name is [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 56943877 |
| Molecular Formula | C40H46F2N6O7 |
| Molecular Weight | 760.84 g/mol |
| Exact Mass | 760.34 |
| IUPAC Name | [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1cc(F)c(F)cc1-c1ccc2nc(N)nc(C(=O)N3Cc4ccccc4C3)c2c1 |
| InChI | InChI=1S/C40H46F2N6O7/c1-39(2,3)54-37(51)44-16-10-9-13-32(46-38(52)55-40(4,5)6)35(50)53-22-26-18-29(41)30(42)19-27(26)23-14-15-31-28(17-23)33(47-36(43)45-31)34(49)48-20-24-11-7-8-12-25(24)21-48/h7-8,11-12,14-15,17-19,32H,9-10,13,16,20-22H2,1-6H3,(H,44,51)(H,46,52)(H2,43,45,47)/t32-/m0/s1 |
| InChIKey | IJWBDEMXOXYXAG-YTTGMZPUSA-N |
| XLogP | 6.94 |
| TPSA | 175.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.84 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|