C30H30F2N6O3 — CID 56943971
[2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-diaminohexanoate (PubChem CID 56943971) has the molecular formula C30H30F2N6O3 and a molecular weight of 560.61 g/mol. Its IUPAC name is [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-diaminohexanoate.
| Compound Name | [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 56943971 |
| Molecular Formula | C30H30F2N6O3 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4,5-difluorophenyl]methyl (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)OCc1cc(F)c(F)cc1-c1ccc2nc(N)nc(C(=O)N3Cc4ccccc4C3)c2c1 |
| InChI | InChI=1S/C30H30F2N6O3/c31-23-12-20(16-41-29(40)25(34)7-3-4-10-33)21(13-24(23)32)17-8-9-26-22(11-17)27(37-30(35)36-26)28(39)38-14-18-5-1-2-6-19(18)15-38/h1-2,5-6,8-9,11-13,25H,3-4,7,10,14-16,33-34H2,(H2,35,36,37)/t25-/m0/s1 |
| InChIKey | TZZLAKXZPRJTIT-VWLOTQADSA-N |
| XLogP | 3.81 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|