C30H31FN6O3 — CID 56943972
[2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4-fluorophenyl]methyl (2S)-2,6-diaminohexanoate (PubChem CID 56943972) has the molecular formula C30H31FN6O3 and a molecular weight of 542.62 g/mol. Its IUPAC name is [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4-fluorophenyl]methyl (2S)-2,6-diaminohexanoate.
| Compound Name | [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4-fluorophenyl]methyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 56943972 |
| Molecular Formula | C30H31FN6O3 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | [2-[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-4-fluorophenyl]methyl (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)OCc1ccc(F)cc1-c1ccc2nc(N)nc(C(=O)N3Cc4ccccc4C3)c2c1 |
| InChI | InChI=1S/C30H31FN6O3/c31-22-10-8-21(17-40-29(39)25(33)7-3-4-12-32)23(14-22)18-9-11-26-24(13-18)27(36-30(34)35-26)28(38)37-15-19-5-1-2-6-20(19)16-37/h1-2,5-6,8-11,13-14,25H,3-4,7,12,15-17,32-33H2,(H2,34,35,36)/t25-/m0/s1 |
| InChIKey | UTNBNXOIQHCIBV-VWLOTQADSA-N |
| XLogP | 3.67 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|