C31H61N — CID 56944053
(20Z,23Z)-N,N-dimethylnonacosa-20,23-dien-10-amine (PubChem CID 56944053) has the molecular formula C31H61N and a molecular weight of 447.84 g/mol. Its IUPAC name is (20Z,23Z)-N,N-dimethylnonacosa-20,23-dien-10-amine.
| Compound Name | (20Z,23Z)-N,N-dimethylnonacosa-20,23-dien-10-amine |
|---|---|
| PubChem CID | 56944053 |
| Molecular Formula | C31H61N |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.48 |
| IUPAC Name | (20Z,23Z)-N,N-dimethylnonacosa-20,23-dien-10-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC)N(C)C |
| InChI | InChI=1S/C31H61N/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-30-31(32(3)4)29-27-25-23-12-10-8-6-2/h13-14,16-17,31H,5-12,15,18-30H2,1-4H3/b14-13-,17-16- |
| InChIKey | POBBAOCNGBEZJQ-AUGURXLVSA-N |
| XLogP | 10.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|