C28H55N — CID 56944054
(17Z,20Z)-N,N-dimethylhexacosa-17,20-dien-9-amine (PubChem CID 56944054) has the molecular formula C28H55N and a molecular weight of 405.76 g/mol. Its IUPAC name is (17Z,20Z)-N,N-dimethylhexacosa-17,20-dien-9-amine.
| Compound Name | (17Z,20Z)-N,N-dimethylhexacosa-17,20-dien-9-amine |
|---|---|
| PubChem CID | 56944054 |
| Molecular Formula | C28H55N |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.43 |
| IUPAC Name | (17Z,20Z)-N,N-dimethylhexacosa-17,20-dien-9-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCCCCC)N(C)C |
| InChI | InChI=1S/C28H55N/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-23-25-27-28(29(3)4)26-24-22-12-10-8-6-2/h13-14,16-17,28H,5-12,15,18-27H2,1-4H3/b14-13-,17-16- |
| InChIKey | BZVVSXFWEQQFLE-AUGURXLVSA-N |
| XLogP | 9.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|