C27H53N — CID 56944145
(16Z,19Z)-N,N-dimethylpentacosa-16,19-dien-8-amine (PubChem CID 56944145) has the molecular formula C27H53N and a molecular weight of 391.73 g/mol. Its IUPAC name is (16Z,19Z)-N,N-dimethylpentacosa-16,19-dien-8-amine.
| Compound Name | (16Z,19Z)-N,N-dimethylpentacosa-16,19-dien-8-amine |
|---|---|
| PubChem CID | 56944145 |
| Molecular Formula | C27H53N |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 391.42 |
| IUPAC Name | (16Z,19Z)-N,N-dimethylpentacosa-16,19-dien-8-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCCCC)N(C)C |
| InChI | InChI=1S/C27H53N/c1-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-27(28(3)4)25-23-21-10-8-6-2/h12-13,15-16,27H,5-11,14,17-26H2,1-4H3/b13-12-,16-15- |
| InChIKey | ITVJOYPVZICKMZ-QGLGPCELSA-N |
| XLogP | 9.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|