C24H47N — CID 56944146
(13Z,16Z)-N,N-dimethyldocosa-13,16-dien-5-amine (PubChem CID 56944146) has the molecular formula C24H47N and a molecular weight of 349.65 g/mol. Its IUPAC name is (13Z,16Z)-N,N-dimethyldocosa-13,16-dien-5-amine.
| Compound Name | (13Z,16Z)-N,N-dimethyldocosa-13,16-dien-5-amine |
|---|---|
| PubChem CID | 56944146 |
| Molecular Formula | C24H47N |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 349.37 |
| IUPAC Name | (13Z,16Z)-N,N-dimethyldocosa-13,16-dien-5-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCC)N(C)C |
| InChI | InChI=1S/C24H47N/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(25(3)4)22-8-6-2/h11-12,14-15,24H,5-10,13,16-23H2,1-4H3/b12-11-,15-14- |
| InChIKey | VKRSOPFWJRDTME-HDXUUTQWSA-N |
| XLogP | 7.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|