C25H49N — CID 56944148
(14Z,17Z)-N,N-dimethyltricosa-14,17-dien-6-amine (PubChem CID 56944148) has the molecular formula C25H49N and a molecular weight of 363.67 g/mol. Its IUPAC name is (14Z,17Z)-N,N-dimethyltricosa-14,17-dien-6-amine.
| Compound Name | (14Z,17Z)-N,N-dimethyltricosa-14,17-dien-6-amine |
|---|---|
| PubChem CID | 56944148 |
| Molecular Formula | C25H49N |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 363.39 |
| IUPAC Name | (14Z,17Z)-N,N-dimethyltricosa-14,17-dien-6-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCC)N(C)C |
| InChI | InChI=1S/C25H49N/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-25(26(3)4)23-21-8-6-2/h11-12,14-15,25H,5-10,13,16-24H2,1-4H3/b12-11-,15-14- |
| InChIKey | MRGAZQLDRACERW-HDXUUTQWSA-N |
| XLogP | 8.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|