C26H51N — CID 56944149
(15Z,18Z)-N,N-dimethyltetracosa-15,18-dien-7-amine (PubChem CID 56944149) has the molecular formula C26H51N and a molecular weight of 377.70 g/mol. Its IUPAC name is (15Z,18Z)-N,N-dimethyltetracosa-15,18-dien-7-amine.
| Compound Name | (15Z,18Z)-N,N-dimethyltetracosa-15,18-dien-7-amine |
|---|---|
| PubChem CID | 56944149 |
| Molecular Formula | C26H51N |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 377.40 |
| IUPAC Name | (15Z,18Z)-N,N-dimethyltetracosa-15,18-dien-7-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCCC)N(C)C |
| InChI | InChI=1S/C26H51N/c1-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-26(27(3)4)24-22-10-8-6-2/h12-13,15-16,26H,5-11,14,17-25H2,1-4H3/b13-12-,16-15- |
| InChIKey | NYRYVZIUPOHALZ-QGLGPCELSA-N |
| XLogP | 8.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|