C22H26N6O3S — CID 56944189
N-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 56944189) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | N-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 56944189 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCN(c2noc3ccccc23)CC1)c1cnc2ccccn12 |
| InChI | InChI=1S/C22H26N6O3S/c29-32(30,21-17-23-20-9-3-5-12-28(20)21)24-10-4-6-11-26-13-15-27(16-14-26)22-18-7-1-2-8-19(18)31-25-22/h1-3,5,7-9,12,17,24H,4,6,10-11,13-16H2 |
| InChIKey | KGQVGHYBVLHORN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|