C25H24O6 — CID 56944309
7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)chromen-2-one (PubChem CID 56944309) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)chromen-2-one.
| Compound Name | 7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)chromen-2-one |
|---|---|
| PubChem CID | 56944309 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)chromen-2-one |
| SMILES | COc1ccc2c(COc3ccc4ccc(=O)oc4c3CCC(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H24O6/c1-15(2)4-8-20-21(10-5-16-6-11-23(26)31-25(16)20)29-14-17-12-24(27)30-22-13-18(28-3)7-9-19(17)22/h5-7,9-13,15H,4,8,14H2,1-3H3 |
| InChIKey | GVCGQQYPPWHOSY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|