C24H26FN3O3S2 — CID 56944383
N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1-benzothiophene-2-sulfonamide (PubChem CID 56944383) has the molecular formula C24H26FN3O3S2 and a molecular weight of 487.62 g/mol. Its IUPAC name is N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56944383 |
| Molecular Formula | C24H26FN3O3S2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1-benzothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCC(c2noc3cc(F)ccc23)CC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C24H26FN3O3S2/c25-19-7-8-20-21(16-19)31-27-24(20)17-9-13-28(14-10-17)12-4-3-11-26-33(29,30)23-15-18-5-1-2-6-22(18)32-23/h1-2,5-8,15-17,26H,3-4,9-14H2 |
| InChIKey | GXZWKZAOGQRNTL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|