C33H65N — CID 56944531
(13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine (PubChem CID 56944531) has the molecular formula C33H65N and a molecular weight of 475.89 g/mol. Its IUPAC name is (13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine.
| Compound Name | (13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine |
|---|---|
| PubChem CID | 56944531 |
| Molecular Formula | C33H65N |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.51 |
| IUPAC Name | (13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC)CCN(C)C |
| InChI | InChI=1S/C33H65N/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-30-33(31-32-34(3)4)29-27-25-23-12-10-8-6-2/h13-14,16-17,33H,5-12,15,18-32H2,1-4H3/b14-13-,17-16- |
| InChIKey | SYPDLJYRMSBNEX-AUGURXLVSA-N |
| XLogP | 11.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|