C15H17BF7NO7 — CID 56944555
(4-fluoro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 56944555) has the molecular formula C15H17BF7NO7 and a molecular weight of 467.10 g/mol. Its IUPAC name is (4-fluoro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4-fluoro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 56944555 |
| Molecular Formula | C15H17BF7NO7 |
| Molecular Weight | 467.10 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (4-fluoro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCOc1ccc(F)c2c1B(O)OC2CN.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H15BFNO3.2C2HF3O2/c1-2-5-16-8-4-3-7(13)10-9(6-14)17-12(15)11(8)10;2*3-2(4,5)1(6)7/h3-4,9,15H,2,5-6,14H2,1H3;2*(H,6,7) |
| InChIKey | FWOOEDUSHQFTBA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|