C25H17F8N3O3 — CID 56944585
4-[5-[3,4-difluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide (PubChem CID 56944585) has the molecular formula C25H17F8N3O3 and a molecular weight of 559.41 g/mol. Its IUPAC name is 4-[5-[3,4-difluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-[3,4-difluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 56944585 |
| Molecular Formula | C25H17F8N3O3 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 4-[5-[3,4-difluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide |
| SMILES | CO/N=C/CNC(=O)c1ccc(C2=NOC(c3cc(F)c(F)c(C(F)(F)F)c3)(C(F)(F)F)C2)c2ccccc12 |
| InChI | InChI=1S/C25H17F8N3O3/c1-38-35-9-8-34-22(37)17-7-6-16(14-4-2-3-5-15(14)17)20-12-23(39-36-20,25(31,32)33)13-10-18(24(28,29)30)21(27)19(26)11-13/h2-7,9-11H,8,12H2,1H3,(H,34,37)/b35-9+ |
| InChIKey | LRNXFUQDJQVZIX-DQMPJDHPSA-N |
| XLogP | 6.08 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|