C25H18F7N3O3 — CID 56944686
4-[5-[3-fluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide (PubChem CID 56944686) has the molecular formula C25H18F7N3O3 and a molecular weight of 541.42 g/mol. Its IUPAC name is 4-[5-[3-fluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-[3-fluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 56944686 |
| Molecular Formula | C25H18F7N3O3 |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 4-[5-[3-fluoro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2E)-2-methoxyiminoethyl]naphthalene-1-carboxamide |
| SMILES | CO/N=C/CNC(=O)c1ccc(C2=NOC(c3cc(F)cc(C(F)(F)F)c3)(C(F)(F)F)C2)c2ccccc12 |
| InChI | InChI=1S/C25H18F7N3O3/c1-37-34-9-8-33-22(36)20-7-6-19(17-4-2-3-5-18(17)20)21-13-23(38-35-21,25(30,31)32)14-10-15(24(27,28)29)12-16(26)11-14/h2-7,9-12H,8,13H2,1H3,(H,33,36)/b34-9+ |
| InChIKey | JYGZCEPQWBNBQX-IELPSJOKSA-N |
| XLogP | 5.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|