C18H20N2O2 — CID 56945246
[3-(hydroxymethyl)-1,9-dimethyl-4,10-dihydroindolizino[6,7-b]indol-2-yl]methanol (PubChem CID 56945246) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1,9-dimethyl-4,10-dihydroindolizino[6,7-b]indol-2-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-1,9-dimethyl-4,10-dihydroindolizino[6,7-b]indol-2-yl]methanol |
|---|---|
| PubChem CID | 56945246 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [3-(hydroxymethyl)-1,9-dimethyl-4,10-dihydroindolizino[6,7-b]indol-2-yl]methanol |
| SMILES | Cc1c(CO)c(CO)c2n1Cc1c(c3ccccc3n1C)C2 |
| InChI | InChI=1S/C18H20N2O2/c1-11-14(9-21)15(10-22)17-7-13-12-5-3-4-6-16(12)19(2)18(13)8-20(11)17/h3-6,21-22H,7-10H2,1-2H3 |
| InChIKey | WMQXHWFHWSAGQF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|