About 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one
3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one (PubChem CID 56945294) has the molecular formula C21H21NO3
and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one |
| PubChem CID | 56945294 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one |
| SMILES | Cc1cc2oc(-c3ccc(N4CCCC4)cc3)c(O)c(=O)c2cc1C |
| InChI | InChI=1S/C21H21NO3/c1-13-11-17-18(12-14(13)2)25-21(20(24)19(17)23)15-5-7-16(8-6-15)22-9-3-4-10-22/h5-8,11-12,24H,3-4,9-10H2,1-2H3 |
| InChIKey | VXIJBUIFHOWGND-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one?
The IUPAC name of 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one (CID 56945294) is 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one.
What is the SMILES notation for 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one?
The canonical SMILES for 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one is Cc1cc2oc(-c3ccc(N4CCCC4)cc3)c(O)c(=O)c2cc1C.
What is the InChIKey of 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one?
The InChIKey is VXIJBUIFHOWGND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3/c1-13-11-17-18(12-14(13)2)25-21(20(24)19(17)23)15-5-7-16(8-6-15)22-9-3-4-10-22/h5-8,11-12,24H,3-4,9-10H2,1-2H3.
What are the key properties of 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one?
3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one has a molecular weight of 335.40 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6,7-dimethyl-2-(4-pyrrolidin-1-ylphenyl)chromen-4-one is sourced from PubChem (CID 56945294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).