About (E,2S)-1,2-dihydroxydocos-8-en-10-one
(E,2S)-1,2-dihydroxydocos-8-en-10-one (PubChem CID 56945328) has the molecular formula C22H42O3
and a molecular weight of 354.58 g/mol. Its IUPAC name is (E,2S)-1,2-dihydroxydocos-8-en-10-one.
Molecular Properties
| Compound Name | (E,2S)-1,2-dihydroxydocos-8-en-10-one |
| PubChem CID | 56945328 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | (E,2S)-1,2-dihydroxydocos-8-en-10-one |
| SMILES | CCCCCCCCCCCCC(=O)/C=C/CCCCC[C@H](O)CO |
| InChI | InChI=1S/C22H42O3/c1-2-3-4-5-6-7-8-9-11-14-17-21(24)18-15-12-10-13-16-19-22(25)20-23/h15,18,22-23,25H,2-14,16-17,19-20H2,1H3/b18-15+/t22-/m0/s1 |
| InChIKey | FDTPTCBTCOWJGN-LXKWBGADSA-N |
| XLogP | 5.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-1,2-dihydroxydocos-8-en-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-1,2-dihydroxydocos-8-en-10-one?
The IUPAC name of (E,2S)-1,2-dihydroxydocos-8-en-10-one (CID 56945328) is (E,2S)-1,2-dihydroxydocos-8-en-10-one.
What is the SMILES notation for (E,2S)-1,2-dihydroxydocos-8-en-10-one?
The canonical SMILES for (E,2S)-1,2-dihydroxydocos-8-en-10-one is CCCCCCCCCCCCC(=O)/C=C/CCCCC[C@H](O)CO.
What is the InChIKey of (E,2S)-1,2-dihydroxydocos-8-en-10-one?
The InChIKey is FDTPTCBTCOWJGN-LXKWBGADSA-N. The full InChI is InChI=1S/C22H42O3/c1-2-3-4-5-6-7-8-9-11-14-17-21(24)18-15-12-10-13-16-19-22(25)20-23/h15,18,22-23,25H,2-14,16-17,19-20H2,1H3/b18-15+/t22-/m0/s1.
What are the key properties of (E,2S)-1,2-dihydroxydocos-8-en-10-one?
(E,2S)-1,2-dihydroxydocos-8-en-10-one has a molecular weight of 354.58 g/mol, XLogP of 5.73, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-1,2-dihydroxydocos-8-en-10-one is sourced from PubChem (CID 56945328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).