C21H17IN2O5 — CID 56945410
(2R,3S)-1-(9-iodophenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid (PubChem CID 56945410) has the molecular formula C21H17IN2O5 and a molecular weight of 504.28 g/mol. Its IUPAC name is (2R,3S)-1-(9-iodophenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid.
| Compound Name | (2R,3S)-1-(9-iodophenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 56945410 |
| Molecular Formula | C21H17IN2O5 |
| Molecular Weight | 504.28 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | (2R,3S)-1-(9-iodophenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1NCCN(C(=O)c2ccc3cc(I)c4ccccc4c3c2)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H17IN2O5/c22-16-10-11-5-6-12(9-15(11)13-3-1-2-4-14(13)16)19(25)24-8-7-23-17(20(26)27)18(24)21(28)29/h1-6,9-10,17-18,23H,7-8H2,(H,26,27)(H,28,29)/t17-,18+/m0/s1 |
| InChIKey | OETACQDMBICFOM-ZWKOTPCHSA-N |
| XLogP | 2.55 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|