About 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one
5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one (PubChem CID 56945436) has the molecular formula C10H8Cl2N2O3S
and a molecular weight of 307.16 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 56945436 |
| Molecular Formula | C10H8Cl2N2O3S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(CS(=O)(=O)c2cc(Cl)cc(Cl)c2)[nH][nH]1 |
| InChI | InChI=1S/C10H8Cl2N2O3S/c11-6-1-7(12)3-9(2-6)18(16,17)5-8-4-10(15)14-13-8/h1-4H,5H2,(H2,13,14,15) |
| InChIKey | ZEKZANLHBWYBSY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one (CID 56945436) is 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one is O=c1cc(CS(=O)(=O)c2cc(Cl)cc(Cl)c2)[nH][nH]1.
What is the InChIKey of 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one?
The InChIKey is ZEKZANLHBWYBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N2O3S/c11-6-1-7(12)3-9(2-6)18(16,17)5-8-4-10(15)14-13-8/h1-4H,5H2,(H2,13,14,15).
What are the key properties of 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one?
5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one has a molecular weight of 307.16 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dichlorophenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 56945436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).