C15H14F3N5O5 — CID 56945744
2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 56945744) has the molecular formula C15H14F3N5O5 and a molecular weight of 401.30 g/mol. Its IUPAC name is 2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 56945744 |
| Molecular Formula | C15H14F3N5O5 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN[C@@H]1COc2nc([N+](=O)[O-])cn2C1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3N5O5/c16-15(17,18)28-11-3-1-9(2-4-11)20-13(24)5-19-10-6-22-7-12(23(25)26)21-14(22)27-8-10/h1-4,7,10,19H,5-6,8H2,(H,20,24)/t10-/m0/s1 |
| InChIKey | PKYDDDALKOPRKR-JTQLQIEISA-N |
| XLogP | 1.68 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|