C15H13F3N4O6 — CID 56945860
[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-methyl-N-[4-(trifluoromethoxy)phenyl]carbamate (PubChem CID 56945860) has the molecular formula C15H13F3N4O6 and a molecular weight of 402.29 g/mol. Its IUPAC name is [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-methyl-N-[4-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-methyl-N-[4-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 56945860 |
| Molecular Formula | C15H13F3N4O6 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-methyl-N-[4-(trifluoromethoxy)phenyl]carbamate |
| SMILES | CN(C(=O)O[C@@H]1COc2nc([N+](=O)[O-])cn2C1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N4O6/c1-20(9-2-4-10(5-3-9)28-15(16,17)18)14(23)27-11-6-21-7-12(22(24)25)19-13(21)26-8-11/h2-5,7,11H,6,8H2,1H3/t11-/m0/s1 |
| InChIKey | AYJRIPQMNNRHNH-NSHDSACASA-N |
| XLogP | 2.72 |
| TPSA | 108.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|