C15H7F6NO2S — CID 56946145
3-[3,5-bis(trifluoromethyl)phenyl]-1,2-benzothiazole 1,1-dioxide (PubChem CID 56946145) has the molecular formula C15H7F6NO2S and a molecular weight of 379.28 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 56946145 |
| Molecular Formula | C15H7F6NO2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C15H7F6NO2S/c16-14(17,18)9-5-8(6-10(7-9)15(19,20)21)13-11-3-1-2-4-12(11)25(23,24)22-13/h1-7H |
| InChIKey | GGIDFSJWHZMQDA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |