C19H15F3N6O4 — CID 56946287
1-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-3-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]urea (PubChem CID 56946287) has the molecular formula C19H15F3N6O4 and a molecular weight of 448.36 g/mol. Its IUPAC name is 1-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-3-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]urea.
| Compound Name | 1-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-3-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]urea |
|---|---|
| PubChem CID | 56946287 |
| Molecular Formula | C19H15F3N6O4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-3-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2ccc(C(F)(F)F)nc2)cc1)N[C@@H]1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C19H15F3N6O4/c20-19(21,22)15-6-3-12(7-23-15)11-1-4-13(5-2-11)24-17(29)25-14-8-27-9-16(28(30)31)26-18(27)32-10-14/h1-7,9,14H,8,10H2,(H2,24,25,29)/t14-/m0/s1 |
| InChIKey | GMACDTVVZITTBB-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|