C20H18FN5O4 — CID 56946291
1-[[4-(4-fluorophenyl)phenyl]methyl]-3-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]urea (PubChem CID 56946291) has the molecular formula C20H18FN5O4 and a molecular weight of 411.39 g/mol. Its IUPAC name is 1-[[4-(4-fluorophenyl)phenyl]methyl]-3-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]urea.
| Compound Name | 1-[[4-(4-fluorophenyl)phenyl]methyl]-3-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]urea |
|---|---|
| PubChem CID | 56946291 |
| Molecular Formula | C20H18FN5O4 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[[4-(4-fluorophenyl)phenyl]methyl]-3-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]urea |
| SMILES | O=C(NCc1ccc(-c2ccc(F)cc2)cc1)N[C@@H]1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C20H18FN5O4/c21-16-7-5-15(6-8-16)14-3-1-13(2-4-14)9-22-19(27)23-17-10-25-11-18(26(28)29)24-20(25)30-12-17/h1-8,11,17H,9-10,12H2,(H2,22,23,27)/t17-/m0/s1 |
| InChIKey | IORKEBUTVQHWHU-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|