C15H19N3O9 — CID 56946366
[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N-(4-nitrophenyl)carbamate (PubChem CID 56946366) has the molecular formula C15H19N3O9 and a molecular weight of 385.33 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N-(4-nitrophenyl)carbamate.
| Compound Name | [(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 56946366 |
| Molecular Formula | C15H19N3O9 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N-(4-nitrophenyl)carbamate |
| SMILES | CC(=O)N[C@H]1[C@H](OC(=O)Nc2ccc([N+](=O)[O-])cc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H19N3O9/c1-7(20)16-11-13(22)12(21)10(6-19)26-14(11)27-15(23)17-8-2-4-9(5-3-8)18(24)25/h2-5,10-14,19,21-22H,6H2,1H3,(H,16,20)(H,17,23)/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | HTBDKFDPNCDWIC-KSTCHIGDSA-N |
| XLogP | -0.91 |
| TPSA | 180.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|