C20H17IN4O3 — CID 56946380
2-(3,4-dimethoxyanilino)-9-iodo-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 56946380) has the molecular formula C20H17IN4O3 and a molecular weight of 488.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-9-iodo-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 2-(3,4-dimethoxyanilino)-9-iodo-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 56946380 |
| Molecular Formula | C20H17IN4O3 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-9-iodo-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | COc1ccc(Nc2ncc3c(n2)-c2ccc(I)cc2NC(=O)C3)cc1OC |
| InChI | InChI=1S/C20H17IN4O3/c1-27-16-6-4-13(9-17(16)28-2)23-20-22-10-11-7-18(26)24-15-8-12(21)3-5-14(15)19(11)25-20/h3-6,8-10H,7H2,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | SYEIAEYQBUCQFE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|