C25H24F3N3O3 — CID 56946421
(3E)-1-[(1S)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one (PubChem CID 56946421) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is (3E)-1-[(1S)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one.
| Compound Name | (3E)-1-[(1S)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 56946421 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (3E)-1-[(1S)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]piperidin-2-one |
| SMILES | COc1cc(/C=C2\CCCN([C@H](CO)c3cc(F)c(F)c(F)c3)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24F3N3O3/c1-15-12-30(14-29-15)21-6-5-16(9-23(21)34-2)8-17-4-3-7-31(25(17)33)22(13-32)18-10-19(26)24(28)20(27)11-18/h5-6,8-12,14,22,32H,3-4,7,13H2,1-2H3/b17-8+/t22-/m1/s1 |
| InChIKey | ZUHOOSAZGQCPGK-CRAILRFSSA-N |
| XLogP | 4.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|