C24H27ClN6O — CID 56946623
6-chloro-10-methoxy-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaene (PubChem CID 56946623) has the molecular formula C24H27ClN6O and a molecular weight of 450.97 g/mol. Its IUPAC name is 6-chloro-10-methoxy-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaene.
| Compound Name | 6-chloro-10-methoxy-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaene |
|---|---|
| PubChem CID | 56946623 |
| Molecular Formula | C24H27ClN6O |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 6-chloro-10-methoxy-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaene |
| SMILES | COc1ccc2cc1Nc1nc(ncc1Cl)Nc1ccc(N3CCN(C)CC3)c(c1)CC2 |
| InChI | InChI=1S/C24H27ClN6O/c1-30-9-11-31(12-10-30)21-7-6-18-14-17(21)5-3-16-4-8-22(32-2)20(13-16)28-23-19(25)15-26-24(27-18)29-23/h4,6-8,13-15H,3,5,9-12H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | JFIOXJDLOAVMBY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|